C37H40N2O5Si — CID 23901707
N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23901707) has the molecular formula C37H40N2O5Si and a molecular weight of 620.82 g/mol. Its IUPAC name is N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23901707 |
| Molecular Formula | C37H40N2O5Si |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | N-[(3S,3'S,4'R,5'S)-1-benzyl-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(Cc4ccccc4)c4ccc(NC(=O)c5ccccc5)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C37H40N2O5Si/c1-25-34(45(3,4)30-18-16-29(43-2)17-19-30)33(21-22-40)44-37(25)31-23-28(38-35(41)27-13-9-6-10-14-27)15-20-32(31)39(36(37)42)24-26-11-7-5-8-12-26/h5-20,23,25,33-34,40H,21-22,24H2,1-4H3,(H,38,41)/t25-,33+,34-,37+/m1/s1 |
| InChIKey | LBFRVSDSPXVUGE-LOWDZQGASA-N |
| XLogP | 6.09 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|