C32H35FN2O5 — CID 23958237
N-[(3R,3'S,4'S,5'R)-1-benzyl-4'-(2-fluoropropan-2-yl)-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide (PubChem CID 23958237) has the molecular formula C32H35FN2O5 and a molecular weight of 546.64 g/mol. Its IUPAC name is N-[(3R,3'S,4'S,5'R)-1-benzyl-4'-(2-fluoropropan-2-yl)-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide.
| Compound Name | N-[(3R,3'S,4'S,5'R)-1-benzyl-4'-(2-fluoropropan-2-yl)-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23958237 |
| Molecular Formula | C32H35FN2O5 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-[(3R,3'S,4'S,5'R)-1-benzyl-4'-(2-fluoropropan-2-yl)-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)[C@@]2(O[C@H](CCO)[C@@H](C(C)(C)F)[C@@H]2C)C(=O)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C32H35FN2O5/c1-20-28(31(2,3)33)27(16-17-36)40-32(20)25-18-23(34-29(37)22-10-13-24(39-4)14-11-22)12-15-26(25)35(30(32)38)19-21-8-6-5-7-9-21/h5-15,18,20,27-28,36H,16-17,19H2,1-4H3,(H,34,37)/t20-,27+,28-,32+/m0/s1 |
| InChIKey | NKDDEYLAZSKGSI-JLOJGFKFSA-N |
| XLogP | 5.47 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |