C37H38FN3O5Si — CID 23872876
N-[(3R,3'R,4'S,5'R)-1-[(3-benzamidophenyl)methyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23872876) has the molecular formula C37H38FN3O5Si and a molecular weight of 651.81 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-1-[(3-benzamidophenyl)methyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-1-[(3-benzamidophenyl)methyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23872876 |
| Molecular Formula | C37H38FN3O5Si |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-1-[(3-benzamidophenyl)methyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(Cc1cccc(NC(=O)c3ccccc3)c1)c1ccc(NC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C37H38FN3O5Si/c1-24-33(47(2,3)38)32(19-20-42)46-37(24)30-22-29(40-35(44)27-14-8-5-9-15-27)17-18-31(30)41(36(37)45)23-25-11-10-16-28(21-25)39-34(43)26-12-6-4-7-13-26/h4-18,21-22,24,32-33,42H,19-20,23H2,1-3H3,(H,39,43)(H,40,44)/t24-,32+,33-,37+/m0/s1 |
| InChIKey | LXBOCLSCRXKZJP-KJXVLIPDSA-N |
| XLogP | 6.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|