C30H33FN2O4Si — CID 23816570
N-[4-[[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide (PubChem CID 23816570) has the molecular formula C30H33FN2O4Si and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[4-[[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-[4-[[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23816570 |
| Molecular Formula | C30H33FN2O4Si |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | N-[4-[[(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(Cc1ccc(NC(=O)c3ccccc3)cc1)c1ccccc12 |
| InChI | InChI=1S/C30H33FN2O4Si/c1-20-27(38(2,3)31)26(17-18-34)37-30(20)24-11-7-8-12-25(24)33(29(30)36)19-21-13-15-23(16-14-21)32-28(35)22-9-5-4-6-10-22/h4-16,20,26-27,34H,17-19H2,1-3H3,(H,32,35)/t20-,26+,27-,30+/m0/s1 |
| InChIKey | FTEOKARMPNDMSR-QPZJPMIKSA-N |
| XLogP | 5.64 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|