C39H42FN3O5Si — CID 23788285
N-[4-[[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide (PubChem CID 23788285) has the molecular formula C39H42FN3O5Si and a molecular weight of 679.87 g/mol. Its IUPAC name is N-[4-[[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-[4-[[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 23788285 |
| Molecular Formula | C39H42FN3O5Si |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.29 |
| IUPAC Name | N-[4-[[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]benzamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@]12C(=O)N(Cc1ccc(NC(=O)c3ccccc3)cc1)c1ccccc12 |
| InChI | InChI=1S/C39H42FN3O5Si/c1-27-36(49(2,3)40)34(24-35(45)42(22-23-44)25-28-12-6-4-7-13-28)48-39(27)32-16-10-11-17-33(32)43(38(39)47)26-29-18-20-31(21-19-29)41-37(46)30-14-8-5-9-15-30/h4-21,27,34,36,44H,22-26H2,1-3H3,(H,41,46)/t27-,34+,36-,39+/m1/s1 |
| InChIKey | WOGNWSGAUVSENJ-VJLFBTONSA-N |
| XLogP | 6.67 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|