C33H39FN4O5Si — CID 23956139
4-amino-N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23956139) has the molecular formula C33H39FN4O5Si and a molecular weight of 618.78 g/mol. Its IUPAC name is 4-amino-N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | 4-amino-N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23956139 |
| Molecular Formula | C33H39FN4O5Si |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 4-amino-N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@]12C(=O)N(C)c1ccc(NC(=O)c3ccc(N)cc3)cc12 |
| InChI | InChI=1S/C33H39FN4O5Si/c1-21-30(44(3,4)34)28(19-29(40)38(16-17-39)20-22-8-6-5-7-9-22)43-33(21)26-18-25(14-15-27(26)37(2)32(33)42)36-31(41)23-10-12-24(35)13-11-23/h5-15,18,21,28,30,39H,16-17,19-20,35H2,1-4H3,(H,36,41)/t21-,28+,30-,33+/m0/s1 |
| InChIKey | GIFSLHJXWMGFFL-WYFQUBHJSA-N |
| XLogP | 4.68 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|