C32H36FN3O5Si — CID 23872372
N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide (PubChem CID 23872372) has the molecular formula C32H36FN3O5Si and a molecular weight of 589.74 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide |
|---|---|
| PubChem CID | 23872372 |
| Molecular Formula | C32H36FN3O5Si |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[fluoro(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]benzamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@]12C(=O)Nc1ccc(NC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C32H36FN3O5Si/c1-21-29(42(2,3)33)27(19-28(38)36(16-17-37)20-22-10-6-4-7-11-22)41-32(21)25-18-24(14-15-26(25)35-31(32)40)34-30(39)23-12-8-5-9-13-23/h4-15,18,21,27,29,37H,16-17,19-20H2,1-3H3,(H,34,39)(H,35,40)/t21-,27+,29-,32+/m0/s1 |
| InChIKey | YYVHVGNUYBHNBK-IVRHHXQPSA-N |
| XLogP | 5.08 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|