C31H42N4O6Si — CID 23956459
N-[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide (PubChem CID 23956459) has the molecular formula C31H42N4O6Si and a molecular weight of 594.79 g/mol. Its IUPAC name is N-[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide.
| Compound Name | N-[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23956459 |
| Molecular Formula | C31H42N4O6Si |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | N-[(3S,3'S,4'R,5'S)-5'-[2-[benzyl(2-hydroxyethyl)amino]-2-oxoethyl]-4'-[hydroxy(dimethyl)silyl]-3'-methyl-2-oxospiro[1H-indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@]12C(=O)Nc1ccc(NC(=O)C3CCCNC3)cc12 |
| InChI | InChI=1S/C31H42N4O6Si/c1-20-28(42(2,3)40)26(17-27(37)35(14-15-36)19-21-8-5-4-6-9-21)41-31(20)24-16-23(11-12-25(24)34-30(31)39)33-29(38)22-10-7-13-32-18-22/h4-6,8-9,11-12,16,20,22,26,28,32,36,40H,7,10,13-15,17-19H2,1-3H3,(H,33,38)(H,34,39)/t20-,22?,26+,28-,31+/m1/s1 |
| InChIKey | NXCNMNOHJNGTOW-YCGKVFSPSA-N |
| XLogP | 2.79 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|