C29H39N3O5Si — CID 23817259
N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide (PubChem CID 23817259) has the molecular formula C29H39N3O5Si and a molecular weight of 537.73 g/mol. Its IUPAC name is N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide.
| Compound Name | N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 23817259 |
| Molecular Formula | C29H39N3O5Si |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | N-[(3R,3'R,4'S,5'R)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]piperidine-3-carboxamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@]12C(=O)N(Cc1ccccc1)c1ccc(NC(=O)C3CCCNC3)cc12 |
| InChI | InChI=1S/C29H39N3O5Si/c1-19-26(38(2,3)36)25(13-15-33)37-29(19)23-16-22(31-27(34)21-10-7-14-30-17-21)11-12-24(23)32(28(29)35)18-20-8-5-4-6-9-20/h4-6,8-9,11-12,16,19,21,25-26,30,33,36H,7,10,13-15,17-18H2,1-3H3,(H,31,34)/t19-,21?,25+,26-,29+/m0/s1 |
| InChIKey | HDBQNBMKEGLQKI-RIAFWEDXSA-N |
| XLogP | 3.35 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|