C26H34N2O6Si — CID 23844401
(2S)-N-[(3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide (PubChem CID 23844401) has the molecular formula C26H34N2O6Si and a molecular weight of 498.65 g/mol. Its IUPAC name is (2S)-N-[(3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 23844401 |
| Molecular Formula | C26H34N2O6Si |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2S)-N-[(3S,3'S,4'R,5'S)-1-benzyl-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)Nc1ccc2c(c1)[C@]1(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]1C)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H34N2O6Si/c1-16-23(35(3,4)33)22(12-13-29)34-26(16)20-14-19(27-24(31)17(2)30)10-11-21(20)28(25(26)32)15-18-8-6-5-7-9-18/h5-11,14,16-17,22-23,29-30,33H,12-13,15H2,1-4H3,(H,27,31)/t16-,17+,22+,23-,26+/m1/s1 |
| InChIKey | JJBFTMKKZFXJIT-JVLAVYFBSA-N |
| XLogP | 2.73 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|