C20H29FN2O5Si — CID 23786953
(2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide (PubChem CID 23786953) has the molecular formula C20H29FN2O5Si and a molecular weight of 424.55 g/mol. Its IUPAC name is (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide.
| Compound Name | (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 23786953 |
| Molecular Formula | C20H29FN2O5Si |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (2S)-N-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-2-hydroxypropanamide |
| SMILES | C[C@H](O)C(=O)Nc1ccc2c(c1)[C@]1(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]1C)C(=O)N2C |
| InChI | InChI=1S/C20H29FN2O5Si/c1-11-17(29(4,5)21)16(8-9-24)28-20(11)14-10-13(22-18(26)12(2)25)6-7-15(14)23(3)19(20)27/h6-7,10-12,16-17,24-25H,8-9H2,1-5H3,(H,22,26)/t11-,12+,16+,17-,20+/m1/s1 |
| InChIKey | GJINVZVUGUXERJ-BGUKZKQHSA-N |
| XLogP | 2.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|