C29H39N3O5Si — CID 23815536
(2R)-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]pyrrolidine-2-carboxamide (PubChem CID 23815536) has the molecular formula C29H39N3O5Si and a molecular weight of 537.73 g/mol. Its IUPAC name is (2R)-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23815536 |
| Molecular Formula | C29H39N3O5Si |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (2R)-N-[(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(C)c4ccc(NC(=O)[C@H]5CCCN5)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C29H39N3O5Si/c1-18-26(38(4,5)21-11-9-20(36-3)10-12-21)25(14-16-33)37-29(18)22-17-19(8-13-24(22)32(2)28(29)35)31-27(34)23-7-6-15-30-23/h8-13,17-18,23,25-26,30,33H,6-7,14-16H2,1-5H3,(H,31,34)/t18-,23+,25+,26-,29+/m0/s1 |
| InChIKey | ODAHKETWMCZQPA-SMLRNPIDSA-N |
| XLogP | 2.96 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|