C31H35N3O5Si — CID 23956297
(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(3-oxo-1H-indazol-2-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23956297) has the molecular formula C31H35N3O5Si and a molecular weight of 557.72 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(3-oxo-1H-indazol-2-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(3-oxo-1H-indazol-2-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956297 |
| Molecular Formula | C31H35N3O5Si |
| Molecular Weight | 557.72 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(3-oxo-1H-indazol-2-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(C)c4ccc(-n5[nH]c6ccccc6c5=O)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C31H35N3O5Si/c1-19-28(40(4,5)22-13-11-21(38-3)12-14-22)27(16-17-35)39-31(19)24-18-20(10-15-26(24)33(2)30(31)37)34-29(36)23-8-6-7-9-25(23)32-34/h6-15,18-19,27-28,32,35H,16-17H2,1-5H3/t19-,27+,28-,31+/m1/s1 |
| InChIKey | DLOGYYMXLNGDFN-LENDCNGZSA-N |
| XLogP | 3.90 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|