C30H36N2O6Si — CID 23956299
(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23956299) has the molecular formula C30H36N2O6Si and a molecular weight of 548.71 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956299 |
| Molecular Formula | C30H36N2O6Si |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(C)c4ccc(-n5cccc(OC)c5=O)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C30H36N2O6Si/c1-19-27(39(5,6)22-12-10-21(36-3)11-13-22)25(15-17-33)38-30(19)23-18-20(9-14-24(23)31(2)29(30)35)32-16-7-8-26(37-4)28(32)34/h7-14,16,18-19,25,27,33H,15,17H2,1-6H3/t19-,25+,27-,30+/m1/s1 |
| InChIKey | LERYTVYLWXJTTI-NTNAXPLLSA-N |
| XLogP | 3.43 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|