C28H38N2O8Si — CID 23872602
methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23872602) has the molecular formula C28H38N2O8Si and a molecular weight of 558.70 g/mol. Its IUPAC name is methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23872602 |
| Molecular Formula | C28H38N2O8Si |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@]2(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]2C)c2cc(-n3cccc(OC)c3=O)ccc21 |
| InChI | InChI=1S/C28H38N2O8Si/c1-18-25(39(4,5)35)22(13-16-31)38-28(18)20-17-19(29-15-8-9-23(36-2)26(29)33)11-12-21(20)30(27(28)34)14-7-6-10-24(32)37-3/h8-9,11-12,15,17-18,22,25,31,35H,6-7,10,13-14,16H2,1-5H3/t18-,22+,25-,28+/m1/s1 |
| InChIKey | STLMBCPWNMMPCT-UEKVNFPGSA-N |
| XLogP | 2.72 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|