C23H35NO7Si — CID 23900525
methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23900525) has the molecular formula C23H35NO7Si and a molecular weight of 465.62 g/mol. Its IUPAC name is methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23900525 |
| Molecular Formula | C23H35NO7Si |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@]2(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]2C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C23H35NO7Si/c1-15-21(32(4,5)28)19(11-13-25)31-23(15)17-14-16(29-2)9-10-18(17)24(22(23)27)12-7-6-8-20(26)30-3/h9-10,14-15,19,21,25,28H,6-8,11-13H2,1-5H3/t15-,19+,21-,23+/m1/s1 |
| InChIKey | NQFKCTFQUZSZTH-FDRNHLPGSA-N |
| XLogP | 2.57 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|