C33H43IN4O6Si — CID 23956042
methyl 5-[(3R,3'R,4'S,5'R)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23956042) has the molecular formula C33H43IN4O6Si and a molecular weight of 746.72 g/mol. Its IUPAC name is methyl 5-[(3R,3'R,4'S,5'R)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3R,3'R,4'S,5'R)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23956042 |
| Molecular Formula | C33H43IN4O6Si |
| Molecular Weight | 746.72 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | methyl 5-[(3R,3'R,4'S,5'R)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@]2(O[C@H](CCn3cc(CCO)nn3)[C@@H]([Si](C)(C)c3ccc(OC)cc3)[C@@H]2C)c2cc(I)ccc21 |
| InChI | InChI=1S/C33H43IN4O6Si/c1-22-31(45(4,5)26-12-10-25(42-2)11-13-26)29(15-18-37-21-24(16-19-39)35-36-37)44-33(22)27-20-23(34)9-14-28(27)38(32(33)41)17-7-6-8-30(40)43-3/h9-14,20-22,29,31,39H,6-8,15-19H2,1-5H3/t22-,29+,31-,33+/m0/s1 |
| InChIKey | WNUDDDGVAOZGLC-ZVTQMECVSA-N |
| XLogP | 4.42 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.72 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|