C36H43N5O6Si — CID 23984154
N-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide (PubChem CID 23984154) has the molecular formula C36H43N5O6Si and a molecular weight of 669.86 g/mol. Its IUPAC name is N-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide.
| Compound Name | N-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 23984154 |
| Molecular Formula | C36H43N5O6Si |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | N-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-2-oxospiro[indole-3,2'-oxolane]-5-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)[C@]2(O[C@@H](CCn4cc(CCO)nn4)[C@H]([Si](C)(C)c4ccc(OC)cc4)[C@H]2C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C36H43N5O6Si/c1-23-33(48(5,6)29-14-12-28(46-4)13-15-29)32(17-19-41-22-26(18-20-42)38-39-41)47-36(23)30-21-25(9-16-31(30)40(2)35(36)44)37-34(43)24-7-10-27(45-3)11-8-24/h7-16,21-23,32-33,42H,17-20H2,1-6H3,(H,37,43)/t23-,32+,33-,36+/m1/s1 |
| InChIKey | CWOGMPKWGBZFLZ-KOIQQAOASA-N |
| XLogP | 4.37 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|