C33H44N4O6Si — CID 23900538
methyl 5-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23900538) has the molecular formula C33H44N4O6Si and a molecular weight of 620.82 g/mol. Its IUPAC name is methyl 5-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23900538 |
| Molecular Formula | C33H44N4O6Si |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | methyl 5-[(3S,3'S,4'R,5'S)-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@]2(O[C@@H](CCn3cc(CCO)nn3)[C@H]([Si](C)(C)c3ccc(OC)cc3)[C@H]2C)c2ccccc21 |
| InChI | InChI=1S/C33H44N4O6Si/c1-23-31(44(4,5)26-15-13-25(41-2)14-16-26)29(17-20-36-22-24(18-21-38)34-35-36)43-33(23)27-10-6-7-11-28(27)37(32(33)40)19-9-8-12-30(39)42-3/h6-7,10-11,13-16,22-23,29,31,38H,8-9,12,17-21H2,1-5H3/t23-,29+,31-,33+/m1/s1 |
| InChIKey | GILCPEHDXZYFQM-KEAXJVCNSA-N |
| XLogP | 3.82 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|