C32H40FN3O6Si — CID 23786968
methyl 5-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-1-yl]pentanoate (PubChem CID 23786968) has the molecular formula C32H40FN3O6Si and a molecular weight of 609.77 g/mol. Its IUPAC name is methyl 5-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-1-yl]pentanoate.
| Compound Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-1-yl]pentanoate |
|---|---|
| PubChem CID | 23786968 |
| Molecular Formula | C32H40FN3O6Si |
| Molecular Weight | 609.77 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | methyl 5-[(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-2-oxo-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-1-yl]pentanoate |
| SMILES | COC(=O)CCCCN1C(=O)[C@@]2(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]2C)c2cc(N3N=C(c4ccccc4)CCC3=O)ccc21 |
| InChI | InChI=1S/C32H40FN3O6Si/c1-21-30(43(3,4)33)27(17-19-37)42-32(21)24-20-23(36-28(38)16-14-25(34-36)22-10-6-5-7-11-22)13-15-26(24)35(31(32)40)18-9-8-12-29(39)41-2/h5-7,10-11,13,15,20-21,27,30,37H,8-9,12,14,16-19H2,1-4H3/t21-,27+,30-,32+/m1/s1 |
| InChIKey | OVPHCQCFGFBJSR-VUCCPVJVSA-N |
| XLogP | 5.07 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|