C34H39N3O5Si — CID 23786923
(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23786923) has the molecular formula C34H39N3O5Si and a molecular weight of 597.79 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23786923 |
| Molecular Formula | C34H39N3O5Si |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-1,3'-dimethyl-5-(6-oxo-3-phenyl-4,5-dihydropyridazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(C)c4ccc(N5N=C(c6ccccc6)CCC5=O)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C34H39N3O5Si/c1-22-32(43(4,5)26-14-12-25(41-3)13-15-26)30(19-20-38)42-34(22)27-21-24(11-17-29(27)36(2)33(34)40)37-31(39)18-16-28(35-37)23-9-7-6-8-10-23/h6-15,17,21-22,30,32,38H,16,18-20H2,1-5H3/t22-,30+,32-,34+/m1/s1 |
| InChIKey | QKFCFTJHPQUZHG-UTEHFRKNSA-N |
| XLogP | 4.80 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|