C37H38N2O6Si — CID 23956006
(3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23956006) has the molecular formula C37H38N2O6Si and a molecular weight of 634.81 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956006 |
| Molecular Formula | C37H38N2O6Si |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.25 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-5-(3-oxo-1,4-benzoxazin-4-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(c4ccccc4)c4ccc(N5C(=O)COc6ccccc65)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C37H38N2O6Si/c1-24-35(46(3,4)28-17-15-27(43-2)16-18-28)33(20-21-40)45-37(24)29-22-26(38-31-12-8-9-13-32(31)44-23-34(38)41)14-19-30(29)39(36(37)42)25-10-6-5-7-11-25/h5-19,22,24,33,35,40H,20-21,23H2,1-4H3/t24-,33+,35-,37+/m0/s1 |
| InChIKey | KOKZGHVWQGXITO-DWMIWDEDSA-N |
| XLogP | 6.03 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|