C36H39ClN2O6Si — CID 23957238
(3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23957238) has the molecular formula C36H39ClN2O6Si and a molecular weight of 659.26 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23957238 |
| Molecular Formula | C36H39ClN2O6Si |
| Molecular Weight | 659.26 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-1-[[3-(3-methoxy-2-oxo-1-pyridinyl)phenyl]methyl]-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(Cc4cccc(-n5cccc(OC)c5=O)c4)c4ccc(Cl)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C36H39ClN2O6Si/c1-23-33(46(4,5)28-14-12-27(43-2)13-15-28)31(17-19-40)45-36(23)29-21-25(37)11-16-30(29)39(35(36)42)22-24-8-6-9-26(20-24)38-18-7-10-32(44-3)34(38)41/h6-16,18,20-21,23,31,33,40H,17,19,22H2,1-5H3/t23-,31+,33-,36+/m1/s1 |
| InChIKey | GYKDIOUXUAASNZ-WPVMFJKBSA-N |
| XLogP | 5.65 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|