C34H40ClN3O5Si — CID 23901134
(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23901134) has the molecular formula C34H40ClN3O5Si and a molecular weight of 634.25 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23901134 |
| Molecular Formula | C34H40ClN3O5Si |
| Molecular Weight | 634.25 g/mol |
| Exact Mass | 633.24 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4cccc(N5CCNCC5=O)c4)c4ccc(Cl)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C34H40ClN3O5Si/c1-22-32(44(3,4)27-11-9-26(42-2)10-12-27)30(14-17-39)43-34(22)28-19-24(35)8-13-29(28)38(33(34)41)21-23-6-5-7-25(18-23)37-16-15-36-20-31(37)40/h5-13,18-19,22,30,32,36,39H,14-17,20-21H2,1-4H3/t22-,30+,32-,34+/m0/s1 |
| InChIKey | JUQSBPXZPKMBDI-XBVKLVQDSA-N |
| XLogP | 4.43 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|