C27H34ClN3O5Si — CID 23788148
(3S,3'S,4'R,5'S)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23788148) has the molecular formula C27H34ClN3O5Si and a molecular weight of 544.12 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23788148 |
| Molecular Formula | C27H34ClN3O5Si |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5-chloro-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCO)O[C@@]12C(=O)N(Cc1ccc(N3CCNCC3=O)cc1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C27H34ClN3O5Si/c1-17-25(37(2,3)35)23(10-13-32)36-27(17)21-14-19(28)6-9-22(21)31(26(27)34)16-18-4-7-20(8-5-18)30-12-11-29-15-24(30)33/h4-9,14,17,23,25,29,32,35H,10-13,15-16H2,1-3H3/t17-,23+,25-,27+/m1/s1 |
| InChIKey | LUXHLCJEFFZWPQ-IRMQCVJKSA-N |
| XLogP | 3.00 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|