C35H41ClN2O5Si — CID 23929125
(3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23929125) has the molecular formula C35H41ClN2O5Si and a molecular weight of 633.26 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23929125 |
| Molecular Formula | C35H41ClN2O5Si |
| Molecular Weight | 633.26 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4ccc(N5CCCCC5=O)cc4)c4ccc(Cl)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C35H41ClN2O5Si/c1-23-33(44(3,4)28-15-13-27(42-2)14-16-28)31(18-20-39)43-35(23)29-21-25(36)10-17-30(29)38(34(35)41)22-24-8-11-26(12-9-24)37-19-6-5-7-32(37)40/h8-17,21,23,31,33,39H,5-7,18-20,22H2,1-4H3/t23-,31+,33-,35+/m0/s1 |
| InChIKey | FQSZOMWWIAMSAI-ICJTWEQASA-N |
| XLogP | 6.01 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.26 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|