C35H42N2O5Si — CID 23900020
(3R,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23900020) has the molecular formula C35H42N2O5Si and a molecular weight of 598.82 g/mol. Its IUPAC name is (3R,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23900020 |
| Molecular Formula | C35H42N2O5Si |
| Molecular Weight | 598.82 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (3R,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@]3(C(=O)N(Cc4cccc(N5CCCCC5=O)c4)c4ccccc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C35H42N2O5Si/c1-24-33(43(3,4)28-17-15-27(41-2)16-18-28)31(19-21-38)42-35(24)29-12-5-6-13-30(29)37(34(35)40)23-25-10-9-11-26(22-25)36-20-8-7-14-32(36)39/h5-6,9-13,15-18,22,24,31,33,38H,7-8,14,19-21,23H2,1-4H3/t24-,31+,33-,35-/m1/s1 |
| InChIKey | DHMQYPSHYIMNHO-MQMRZXEGSA-N |
| XLogP | 5.36 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.82 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|