C30H39FN2O4Si — CID 23845580
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23845580) has the molecular formula C30H39FN2O4Si and a molecular weight of 538.74 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23845580 |
| Molecular Formula | C30H39FN2O4Si |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCO)O[C@@]12C(=O)N(Cc1cccc(N3CCCCCCC3=O)c1)c1ccccc12 |
| InChI | InChI=1S/C30H39FN2O4Si/c1-21-28(38(2,3)31)26(16-18-34)37-30(21)24-13-7-8-14-25(24)33(29(30)36)20-22-11-10-12-23(19-22)32-17-9-5-4-6-15-27(32)35/h7-8,10-14,19,21,26,28,34H,4-6,9,15-18,20H2,1-3H3/t21-,26+,28-,30+/m1/s1 |
| InChIKey | PPFRTYYTQXWIOY-TXQUKWATSA-N |
| XLogP | 5.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|