C28H34BrFN2O4Si — CID 23873190
(3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23873190) has the molecular formula C28H34BrFN2O4Si and a molecular weight of 589.58 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23873190 |
| Molecular Formula | C28H34BrFN2O4Si |
| Molecular Weight | 589.58 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (3R,3'R,4'S,5'R)-5-bromo-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-1-[[3-(2-oxopiperidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(Cc1cccc(N3CCCCC3=O)c1)c1ccc(Br)cc12 |
| InChI | InChI=1S/C28H34BrFN2O4Si/c1-18-26(37(2,3)30)24(12-14-33)36-28(18)22-16-20(29)10-11-23(22)32(27(28)35)17-19-7-6-8-21(15-19)31-13-5-4-9-25(31)34/h6-8,10-11,15-16,18,24,26,33H,4-5,9,12-14,17H2,1-3H3/t18-,24+,26-,28+/m0/s1 |
| InChIKey | QQIHDSAFBNDPIB-LUFJQHNWSA-N |
| XLogP | 5.67 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|