C31H41FN2O5Si — CID 23759176
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23759176) has the molecular formula C31H41FN2O5Si and a molecular weight of 568.76 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23759176 |
| Molecular Formula | C31H41FN2O5Si |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[3-(2-oxoazocan-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]1C)C(=O)N2Cc1cccc(N2CCCCCCC2=O)c1 |
| InChI | InChI=1S/C31H41FN2O5Si/c1-21-29(40(3,4)32)27(15-17-35)39-31(21)25-19-24(38-2)13-14-26(25)34(30(31)37)20-22-10-9-11-23(18-22)33-16-8-6-5-7-12-28(33)36/h9-11,13-14,18-19,21,27,29,35H,5-8,12,15-17,20H2,1-4H3/t21-,27+,29-,31+/m1/s1 |
| InChIKey | NEWUJATWHGSCDS-NFZXEAEESA-N |
| XLogP | 5.70 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|