C36H42N2O5 — CID 23817996
(3R,3'S,4'R,5'R)-1-benzyl-5'-(2-hydroxyethyl)-4'-[2-(4-methoxyphenyl)propan-2-yl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23817996) has the molecular formula C36H42N2O5 and a molecular weight of 582.74 g/mol. Its IUPAC name is (3R,3'S,4'R,5'R)-1-benzyl-5'-(2-hydroxyethyl)-4'-[2-(4-methoxyphenyl)propan-2-yl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'S,4'R,5'R)-1-benzyl-5'-(2-hydroxyethyl)-4'-[2-(4-methoxyphenyl)propan-2-yl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23817996 |
| Molecular Formula | C36H42N2O5 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | (3R,3'S,4'R,5'R)-1-benzyl-5'-(2-hydroxyethyl)-4'-[2-(4-methoxyphenyl)propan-2-yl]-3'-methyl-5-(2-oxopiperidin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc(C(C)(C)[C@@H]2[C@@H](CCO)O[C@]3(C(=O)N(Cc4ccccc4)c4ccc(N5CCCCC5=O)cc43)[C@H]2C)cc1 |
| InChI | InChI=1S/C36H42N2O5/c1-24-33(35(2,3)26-13-16-28(42-4)17-14-26)31(19-21-39)43-36(24)29-22-27(37-20-9-8-12-32(37)40)15-18-30(29)38(34(36)41)23-25-10-6-5-7-11-25/h5-7,10-11,13-18,22,24,31,33,39H,8-9,12,19-21,23H2,1-4H3/t24-,31+,33-,36+/m0/s1 |
| InChIKey | WWKYVIMDNORNSQ-DIMAWTTQSA-N |
| XLogP | 5.97 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |