C34H40N2O5Si — CID 23788113
(3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23788113) has the molecular formula C34H40N2O5Si and a molecular weight of 584.79 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23788113 |
| Molecular Formula | C34H40N2O5Si |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (3S,3'S,4'R,5'S)-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(Cc4ccc(N5CCCC5=O)cc4)c4ccccc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C34H40N2O5Si/c1-23-32(42(3,4)27-17-15-26(40-2)16-18-27)30(19-21-37)41-34(23)28-8-5-6-9-29(28)36(33(34)39)22-24-11-13-25(14-12-24)35-20-7-10-31(35)38/h5-6,8-9,11-18,23,30,32,37H,7,10,19-22H2,1-4H3/t23-,30+,32-,34+/m1/s1 |
| InChIKey | XMDACKPMFZDIDH-KQAOBPKPSA-N |
| XLogP | 4.97 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|