C28H37N3O6Si — CID 23787794
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23787794) has the molecular formula C28H37N3O6Si and a molecular weight of 539.71 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23787794 |
| Molecular Formula | C28H37N3O6Si |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-methoxy-3'-methyl-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@@]1(O[C@H](CCO)[C@@H]([Si](C)(C)O)[C@@H]1C)C(=O)N2Cc1ccc(N2CCNCC2=O)cc1 |
| InChI | InChI=1S/C28H37N3O6Si/c1-18-26(38(3,4)35)24(11-14-32)37-28(18)22-15-21(36-2)9-10-23(22)31(27(28)34)17-19-5-7-20(8-6-19)30-13-12-29-16-25(30)33/h5-10,15,18,24,26,29,32,35H,11-14,16-17H2,1-4H3/t18-,24+,26-,28+/m0/s1 |
| InChIKey | XNTXARQUUTXPHB-LUFJQHNWSA-N |
| XLogP | 2.36 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|