C27H33FN4O6Si — CID 23845223
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23845223) has the molecular formula C27H33FN4O6Si and a molecular weight of 556.67 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23845223 |
| Molecular Formula | C27H33FN4O6Si |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-1-[[4-(2-oxopiperazin-1-yl)phenyl]methyl]spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCO)O[C@]12C(=O)N(Cc1ccc(N3CCNCC3=O)cc1)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C27H33FN4O6Si/c1-17-25(39(2,3)28)23(10-13-33)38-27(17)21-14-20(32(36)37)8-9-22(21)31(26(27)35)16-18-4-6-19(7-5-18)30-12-11-29-15-24(30)34/h4-9,14,17,23,25,29,33H,10-13,15-16H2,1-3H3/t17-,23+,25-,27+/m0/s1 |
| InChIKey | VBAKSGZEYBQFMM-IBWCPSPISA-N |
| XLogP | 3.24 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|