C23H26FIN2O5Si — CID 23957248
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[(4-iodophenyl)methyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one (PubChem CID 23957248) has the molecular formula C23H26FIN2O5Si and a molecular weight of 584.46 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[(4-iodophenyl)methyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[(4-iodophenyl)methyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23957248 |
| Molecular Formula | C23H26FIN2O5Si |
| Molecular Weight | 584.46 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-1-[(4-iodophenyl)methyl]-3'-methyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCO)O[C@@]12C(=O)N(Cc1ccc(I)cc1)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C23H26FIN2O5Si/c1-14-21(33(2,3)24)20(10-11-28)32-23(14)18-12-17(27(30)31)8-9-19(18)26(22(23)29)13-15-4-6-16(25)7-5-15/h4-9,12,14,20-21,28H,10-11,13H2,1-3H3/t14-,20+,21-,23+/m1/s1 |
| InChIKey | SVJHKNPCEQJNNO-BIRVRANTSA-N |
| XLogP | 4.90 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|