C28H33N3O9Si — CID 23788154
[1-[4-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23788154) has the molecular formula C28H33N3O9Si and a molecular weight of 583.67 g/mol. Its IUPAC name is [1-[4-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[4-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23788154 |
| Molecular Formula | C28H33N3O9Si |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | [1-[4-[[(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | CC(=O)OC1CC(=O)N1c1ccc(CN2C(=O)[C@@]3(O[C@@H](CCO)[C@H]([Si](C)(C)O)[C@H]3C)c3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C28H33N3O9Si/c1-16-26(41(3,4)38)23(11-12-32)40-28(16)21-13-20(31(36)37)9-10-22(21)29(27(28)35)15-18-5-7-19(8-6-18)30-24(34)14-25(30)39-17(2)33/h5-10,13,16,23,25-26,32,38H,11-12,14-15H2,1-4H3/t16-,23+,25?,26-,28+/m1/s1 |
| InChIKey | LLNPXNZYULJPND-FTDKFPKGSA-N |
| XLogP | 2.95 |
| TPSA | 159.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|