C35H39ClN2O7Si — CID 23788123
[1-[3-[[(3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate (PubChem CID 23788123) has the molecular formula C35H39ClN2O7Si and a molecular weight of 663.24 g/mol. Its IUPAC name is [1-[3-[[(3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate.
| Compound Name | [1-[3-[[(3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
|---|---|
| PubChem CID | 23788123 |
| Molecular Formula | C35H39ClN2O7Si |
| Molecular Weight | 663.24 g/mol |
| Exact Mass | 662.22 |
| IUPAC Name | [1-[3-[[(3S,3'S,4'R,5'S)-5-chloro-5'-(2-hydroxyethyl)-4'-[(4-methoxyphenyl)-dimethylsilyl]-3'-methyl-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-4-oxoazetidin-2-yl] acetate |
| SMILES | COc1ccc([Si](C)(C)[C@H]2[C@H](CCO)O[C@@]3(C(=O)N(Cc4cccc(N5C(=O)CC5OC(C)=O)c4)c4ccc(Cl)cc43)[C@@H]2C)cc1 |
| InChI | InChI=1S/C35H39ClN2O7Si/c1-21-33(46(4,5)27-12-10-26(43-3)11-13-27)30(15-16-39)45-35(21)28-18-24(36)9-14-29(28)37(34(35)42)20-23-7-6-8-25(17-23)38-31(41)19-32(38)44-22(2)40/h6-14,17-18,21,30,32-33,39H,15-16,19-20H2,1-5H3/t21-,30+,32?,33-,35+/m1/s1 |
| InChIKey | NITMEPZTJIDNRY-SNOBRVARSA-N |
| XLogP | 5.12 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|