C30H33N3O7Si — CID 23873215
N-[4-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-N-phenylformamide (PubChem CID 23873215) has the molecular formula C30H33N3O7Si and a molecular weight of 575.69 g/mol. Its IUPAC name is N-[4-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-N-phenylformamide.
| Compound Name | N-[4-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-N-phenylformamide |
|---|---|
| PubChem CID | 23873215 |
| Molecular Formula | C30H33N3O7Si |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | N-[4-[[(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-nitro-2-oxospiro[indole-3,2'-oxolane]-1-yl]methyl]phenyl]-N-phenylformamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@]12C(=O)N(Cc1ccc(N(C=O)c3ccccc3)cc1)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C30H33N3O7Si/c1-20-28(41(2,3)39)27(15-16-34)40-30(20)25-17-24(33(37)38)13-14-26(25)31(29(30)36)18-21-9-11-23(12-10-21)32(19-35)22-7-5-4-6-8-22/h4-14,17,19-20,27-28,34,39H,15-16,18H2,1-3H3/t20-,27+,28-,30+/m0/s1 |
| InChIKey | PJZWHJQXPUOKMC-ORWCHIFBSA-N |
| XLogP | 4.62 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|