C32H36IN3O7Si — CID 23985225
N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[hydroxy(dimethyl)silyl]-1-[(4-iodophenyl)methyl]-4'-methyl-5-nitro-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23985225) has the molecular formula C32H36IN3O7Si and a molecular weight of 729.64 g/mol. Its IUPAC name is N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[hydroxy(dimethyl)silyl]-1-[(4-iodophenyl)methyl]-4'-methyl-5-nitro-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[hydroxy(dimethyl)silyl]-1-[(4-iodophenyl)methyl]-4'-methyl-5-nitro-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23985225 |
| Molecular Formula | C32H36IN3O7Si |
| Molecular Weight | 729.64 g/mol |
| Exact Mass | 729.14 |
| IUPAC Name | N-benzyl-2-[(2'S,3S,3'R,4'S)-3'-[hydroxy(dimethyl)silyl]-1-[(4-iodophenyl)methyl]-4'-methyl-5-nitro-2-oxospiro[indole-3,5'-oxolane]-2'-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@]12C(=O)N(Cc1ccc(I)cc1)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C32H36IN3O7Si/c1-21-30(44(2,3)42)28(18-29(38)34(15-16-37)19-22-7-5-4-6-8-22)43-32(21)26-17-25(36(40)41)13-14-27(26)35(31(32)39)20-23-9-11-24(33)12-10-23/h4-14,17,21,28,30,37,42H,15-16,18-20H2,1-3H3/t21-,28+,30-,32+/m1/s1 |
| InChIKey | LSKIZMBLJHQLRG-HEOISILCSA-N |
| XLogP | 4.96 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.64 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|