C30H44FN3O4Si — CID 23928561
(3S,3'S,4'R,5'S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23928561) has the molecular formula C30H44FN3O4Si and a molecular weight of 557.78 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23928561 |
| Molecular Formula | C30H44FN3O4Si |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | (3S,3'S,4'R,5'S)-1-[(2E)-3,7-dimethylocta-2,6-dienyl]-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CN1C(=O)[C@@]2(O[C@@H](CCO)[C@H]([Si](C)(C)F)[C@H]2C)c2cc(N3CCNCC3=O)ccc21 |
| InChI | InChI=1S/C30H44FN3O4Si/c1-20(2)8-7-9-21(3)12-15-34-25-11-10-23(33-16-14-32-19-27(33)36)18-24(25)30(29(34)37)22(4)28(39(5,6)31)26(38-30)13-17-35/h8,10-12,18,22,26,28,32,35H,7,9,13-17,19H2,1-6H3/b21-12+/t22-,26+,28-,30+/m1/s1 |
| InChIKey | IXKFUHPQZXZGQR-QQGRYWOOSA-N |
| XLogP | 4.82 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|