C20H29N3O5Si — CID 23928255
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23928255) has the molecular formula C20H29N3O5Si and a molecular weight of 419.55 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23928255 |
| Molecular Formula | C20H29N3O5Si |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxopiperazin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@]12C(=O)Nc1ccc(N3CCNCC3=O)cc12 |
| InChI | InChI=1S/C20H29N3O5Si/c1-12-18(29(2,3)27)16(6-9-24)28-20(12)14-10-13(4-5-15(14)22-19(20)26)23-8-7-21-11-17(23)25/h4-5,10,12,16,18,21,24,27H,6-9,11H2,1-3H3,(H,22,26)/t12-,16+,18-,20+/m0/s1 |
| InChIKey | LLVZRYBMDUQMSN-GPZWCRHOSA-N |
| XLogP | 0.76 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|