C25H30N2O5Si — CID 23844599
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23844599) has the molecular formula C25H30N2O5Si and a molecular weight of 466.61 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23844599 |
| Molecular Formula | C25H30N2O5Si |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCO)O[C@@]12C(=O)Nc1ccc(N3C(=O)CCc4ccccc43)cc12 |
| InChI | InChI=1S/C25H30N2O5Si/c1-15-23(33(2,3)31)21(12-13-28)32-25(15)18-14-17(9-10-19(18)26-24(25)30)27-20-7-5-4-6-16(20)8-11-22(27)29/h4-7,9-10,14-15,21,23,28,31H,8,11-13H2,1-3H3,(H,26,30)/t15-,21+,23-,25+/m1/s1 |
| InChIKey | GQVDSZNBGQSPBH-XOLBCUTCSA-N |
| XLogP | 3.43 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|