C30H37N5O5Si — CID 23928608
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[indole-3,2'-oxolane]-2-one (PubChem CID 23928608) has the molecular formula C30H37N5O5Si and a molecular weight of 575.74 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23928608 |
| Molecular Formula | C30H37N5O5Si |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-(2-oxo-3,4-dihydroquinolin-1-yl)spiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)O)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(C)c1ccc(N3C(=O)CCc4ccccc43)cc12 |
| InChI | InChI=1S/C30H37N5O5Si/c1-19-28(41(3,4)39)26(13-15-34-18-21(14-16-36)31-32-34)40-30(19)23-17-22(10-11-25(23)33(2)29(30)38)35-24-8-6-5-7-20(24)9-12-27(35)37/h5-8,10-11,17-19,26,28,36,39H,9,12-16H2,1-4H3/t19-,26+,28-,30+/m1/s1 |
| InChIKey | FHNZQMSETDVWRJ-WUXCMYHISA-N |
| XLogP | 3.29 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|