C24H26FN3O4Si — CID 23984118
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(1-oxophthalazin-2-yl)spiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23984118) has the molecular formula C24H26FN3O4Si and a molecular weight of 467.57 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(1-oxophthalazin-2-yl)spiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(1-oxophthalazin-2-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23984118 |
| Molecular Formula | C24H26FN3O4Si |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(1-oxophthalazin-2-yl)spiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCO)O[C@@]12C(=O)Nc1ccc(-n3ncc4ccccc4c3=O)cc12 |
| InChI | InChI=1S/C24H26FN3O4Si/c1-14-21(33(2,3)25)20(10-11-29)32-24(14)18-12-16(8-9-19(18)27-23(24)31)28-22(30)17-7-5-4-6-15(17)13-26-28/h4-9,12-14,20-21,29H,10-11H2,1-3H3,(H,27,31)/t14-,20+,21-,24+/m1/s1 |
| InChIKey | VCMAMNYSBUBLPS-CMQRAJLNSA-N |
| XLogP | 3.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|