C20H26FIN4O3Si — CID 23956050
(3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23956050) has the molecular formula C20H26FIN4O3Si and a molecular weight of 544.44 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23956050 |
| Molecular Formula | C20H26FIN4O3Si |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CCn2cc(CCO)nn2)O[C@]12C(=O)Nc1ccc(I)cc12 |
| InChI | InChI=1S/C20H26FIN4O3Si/c1-12-18(30(2,3)21)17(6-8-26-11-14(7-9-27)24-25-26)29-20(12)15-10-13(22)4-5-16(15)23-19(20)28/h4-5,10-12,17-18,27H,6-9H2,1-3H3,(H,23,28)/t12-,17+,18-,20+/m0/s1 |
| InChIKey | HVJJJGBQSWXIGM-ZBZXEDRXSA-N |
| XLogP | 3.23 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|