C26H33N5O6Si — CID 23928604
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23928604) has the molecular formula C26H33N5O6Si and a molecular weight of 539.67 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23928604 |
| Molecular Formula | C26H33N5O6Si |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-5-(3-methoxy-2-oxo-1-pyridinyl)-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | COc1cccn(-c2ccc3c(c2)[C@]2(O[C@@H](CCn4cc(CCO)nn4)[C@H]([Si](C)(C)O)[C@H]2C)C(=O)N3)c1=O |
| InChI | InChI=1S/C26H33N5O6Si/c1-16-23(38(3,4)35)21(9-12-30-15-17(10-13-32)28-29-30)37-26(16)19-14-18(7-8-20(19)27-25(26)34)31-11-5-6-22(36-2)24(31)33/h5-8,11,14-16,21,23,32,35H,9-10,12-13H2,1-4H3,(H,27,34)/t16-,21+,23-,26+/m1/s1 |
| InChIKey | WHMCOHUCVPHGOM-LQZQFQIBSA-N |
| XLogP | 1.81 |
| TPSA | 140.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|