C26H30FIN4O3Si — CID 23900590
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one (PubChem CID 23900590) has the molecular formula C26H30FIN4O3Si and a molecular weight of 620.54 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23900590 |
| Molecular Formula | C26H30FIN4O3Si |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxy-1-phenylethyl)triazol-1-yl]ethyl]-5-iodo-3'-methylspiro[1H-indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(C(CO)c3ccccc3)nn2)O[C@@]12C(=O)Nc1ccc(I)cc12 |
| InChI | InChI=1S/C26H30FIN4O3Si/c1-16-24(36(2,3)27)23(35-26(16)20-13-18(28)9-10-21(20)29-25(26)34)11-12-32-14-22(30-31-32)19(15-33)17-7-5-4-6-8-17/h4-10,13-14,16,19,23-24,33H,11-12,15H2,1-3H3,(H,29,34)/t16-,19?,23+,24-,26+/m1/s1 |
| InChIKey | SYRVLUCNNWPBMV-MGOVPPLXSA-N |
| XLogP | 4.82 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|