C21H28FN5O5Si — CID 23844624
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-nitrospiro[indole-3,2'-oxolane]-2-one (PubChem CID 23844624) has the molecular formula C21H28FN5O5Si and a molecular weight of 477.57 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-nitrospiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23844624 |
| Molecular Formula | C21H28FN5O5Si |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-[2-[4-(2-hydroxyethyl)triazol-1-yl]ethyl]-1,3'-dimethyl-5-nitrospiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCn2cc(CCO)nn2)O[C@@]12C(=O)N(C)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H28FN5O5Si/c1-13-19(33(3,4)22)18(7-9-26-12-14(8-10-28)23-24-26)32-21(13)16-11-15(27(30)31)5-6-17(16)25(2)20(21)29/h5-6,11-13,18-19,28H,7-10H2,1-4H3/t13-,18+,19-,21+/m1/s1 |
| InChIKey | WDVYIAMZYMLCFJ-AHIVWLDNSA-N |
| XLogP | 2.56 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|