C25H32N2O4Si — CID 23985447
2-[4-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]phthalazin-1-one (PubChem CID 23985447) has the molecular formula C25H32N2O4Si and a molecular weight of 452.63 g/mol. Its IUPAC name is 2-[4-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]phthalazin-1-one.
| Compound Name | 2-[4-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]phthalazin-1-one |
|---|---|
| PubChem CID | 23985447 |
| Molecular Formula | C25H32N2O4Si |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[4-[2-[(2S,3R,4S,5R)-4-[hydroxy(dimethyl)silyl]-5-(2-hydroxyethyl)-3-methyloxolan-2-yl]ethyl]phenyl]phthalazin-1-one |
| SMILES | C[C@H]1[C@H]([Si](C)(C)O)[C@@H](CCO)O[C@H]1CCc1ccc(-n2ncc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H32N2O4Si/c1-17-22(31-23(14-15-28)24(17)32(2,3)30)13-10-18-8-11-20(12-9-18)27-25(29)21-7-5-4-6-19(21)16-26-27/h4-9,11-12,16-17,22-24,28,30H,10,13-15H2,1-3H3/t17-,22+,23-,24+/m1/s1 |
| InChIKey | FUWYYGFRHHAJCD-GMWXCSQMSA-N |
| XLogP | 3.67 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|