C34H40FN3O4Si — CID 23846047
N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[3-(1-oxophthalazin-2-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23846047) has the molecular formula C34H40FN3O4Si and a molecular weight of 601.80 g/mol. Its IUPAC name is N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[3-(1-oxophthalazin-2-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[3-(1-oxophthalazin-2-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23846047 |
| Molecular Formula | C34H40FN3O4Si |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | N-benzyl-2-[(2S,3R,4S,5R)-3-[fluoro(dimethyl)silyl]-4-methyl-5-[2-[3-(1-oxophthalazin-2-yl)phenyl]ethyl]oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CC(=O)N(CCO)Cc2ccccc2)O[C@@H]1CCc1cccc(-n2ncc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C34H40FN3O4Si/c1-24-30(17-16-25-12-9-14-28(20-25)38-34(41)29-15-8-7-13-27(29)22-36-38)42-31(33(24)43(2,3)35)21-32(40)37(18-19-39)23-26-10-5-4-6-11-26/h4-15,20,22,24,30-31,33,39H,16-19,21,23H2,1-3H3/t24-,30+,31-,33+/m0/s1 |
| InChIKey | BMOLYUINMVOAQR-XFZVPMLWSA-N |
| XLogP | 5.68 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|